C18H24F3N3O4S2 — CID 143155603
(2R,3R)-4-[(2R)-2-[[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]sulfanylmethyl]pyrrolidin-1-yl]-2,3-dihydroxy-4-oxo-N-(2-thiophen-2-ylethyl)butanamide (PubChem CID 143155603) has the molecular formula C18H24F3N3O4S2 and a molecular weight of 467.54 g/mol. Its IUPAC name is (2R,3R)-4-[(2R)-2-[[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]sulfanylmethyl]pyrrolidin-1-yl]-2,3-dihydroxy-4-oxo-N-(2-thiophen-2-ylethyl)butanamide.
| Compound Name | (2R,3R)-4-[(2R)-2-[[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]sulfanylmethyl]pyrrolidin-1-yl]-2,3-dihydroxy-4-oxo-N-(2-thiophen-2-ylethyl)butanamide |
|---|---|
| PubChem CID | 143155603 |
| Molecular Formula | C18H24F3N3O4S2 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (2R,3R)-4-[(2R)-2-[[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]sulfanylmethyl]pyrrolidin-1-yl]-2,3-dihydroxy-4-oxo-N-(2-thiophen-2-ylethyl)butanamide |
| SMILES | N/C(=C\SC[C@H]1CCCN1C(=O)[C@H](O)[C@@H](O)C(=O)NCCc1cccs1)C(F)(F)F |
| InChI | InChI=1S/C18H24F3N3O4S2/c19-18(20,21)13(22)10-29-9-11-3-1-7-24(11)17(28)15(26)14(25)16(27)23-6-5-12-4-2-8-30-12/h2,4,8,10-11,14-15,25-26H,1,3,5-7,9,22H2,(H,23,27)/b13-10-/t11-,14-,15-/m1/s1 |
| InChIKey | CWRIJPODODBVRM-ZMWPDXTKSA-N |
| XLogP | 1.22 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |