C9H12F3N — CID 143155923
(2E,4E)-N-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-amine (PubChem CID 143155923) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is (2E,4E)-N-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-N-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 143155923 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (2E,4E)-N-methyl-5-(trifluoromethyl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)NC)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N/c1-4-7(9(10,11)12)6-8(5-2)13-3/h4-6,13H,1H2,2-3H3/b7-6+,8-5+ |
| InChIKey | FBBZNVBLLQKYAN-ZCOYIIAOSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|