About 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol
3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol (PubChem CID 143156354) has the molecular formula C19H28N4O2
and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol.
Molecular Properties
| Compound Name | 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol |
| PubChem CID | 143156354 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol |
| SMILES | C/C=C/CNC(=O)c1ccc2[nH]nc(N)c2c1.C=C(O)/C=C\C.CC |
| InChI | InChI=1S/C12H14N4O.C5H8O.C2H6/c1-2-3-6-14-12(17)8-4-5-10-9(7-8)11(13)16-15-10;1-3-4-5(2)6;1-2/h2-5,7H,6H2,1H3,(H,14,17)(H3,13,15,16);3-4,6H,2H2,1H3;1-2H3/b3-2+;4-3-; |
| InChIKey | ZBWNUXHLDXOKHE-UWPMWHBYSA-N |
| XLogP | 4.11 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol?
The IUPAC name of 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol (CID 143156354) is 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol.
What is the SMILES notation for 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol?
The canonical SMILES for 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol is C/C=C/CNC(=O)c1ccc2[nH]nc(N)c2c1.C=C(O)/C=C\C.CC.
What is the InChIKey of 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol?
The InChIKey is ZBWNUXHLDXOKHE-UWPMWHBYSA-N. The full InChI is InChI=1S/C12H14N4O.C5H8O.C2H6/c1-2-3-6-14-12(17)8-4-5-10-9(7-8)11(13)16-15-10;1-3-4-5(2)6;1-2/h2-5,7H,6H2,1H3,(H,14,17)(H3,13,15,16);3-4,6H,2H2,1H3;1-2H3/b3-2+;4-3-;.
What are the key properties of 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol?
3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol has a molecular weight of 344.46 g/mol, XLogP of 4.11, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[(E)-but-2-enyl]-1H-indazole-5-carboxamide;ethane;(3Z)-penta-1,3-dien-2-ol is sourced from PubChem (CID 143156354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).