C17H16FNO2 — CID 1431564
(2R)-4-[(4-fluorophenyl)methyl]-2,6-dimethyl-1,4-benzoxazin-3-one (PubChem CID 1431564) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is (2R)-4-[(4-fluorophenyl)methyl]-2,6-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | (2R)-4-[(4-fluorophenyl)methyl]-2,6-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 1431564 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2R)-4-[(4-fluorophenyl)methyl]-2,6-dimethyl-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(c1)N(Cc1ccc(F)cc1)C(=O)[C@@H](C)O2 |
| InChI | InChI=1S/C17H16FNO2/c1-11-3-8-16-15(9-11)19(17(20)12(2)21-16)10-13-4-6-14(18)7-5-13/h3-9,12H,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | NFZRYQDYXWZVNZ-GFCCVEGCSA-N |
| XLogP | 3.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |