C15H27N3 — CID 143157306
(5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane;2-ethylguanidine (PubChem CID 143157306) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane;2-ethylguanidine.
| Compound Name | (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane;2-ethylguanidine |
|---|---|
| PubChem CID | 143157306 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;ethane;2-ethylguanidine |
| SMILES | C/C=c1/cccc/c1=C/C.CC.CCN=C(N)N |
| InChI | InChI=1S/C10H12.C3H9N3.C2H6/c1-3-9-7-5-6-8-10(9)4-2;1-2-6-3(4)5;1-2/h3-8H,1-2H3;2H2,1H3,(H4,4,5,6);1-2H3/b9-3-,10-4-;; |
| InChIKey | BXBCQOCAJPKJBK-YMKLDEDPSA-N |
| XLogP | 1.59 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|