C15H25N3 — CID 143157332
(3Z,4Z,6Z)-4-ethenyl-3-ethylideneocta-1,4,6-triene;2-ethylguanidine (PubChem CID 143157332) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (3Z,4Z,6Z)-4-ethenyl-3-ethylideneocta-1,4,6-triene;2-ethylguanidine.
| Compound Name | (3Z,4Z,6Z)-4-ethenyl-3-ethylideneocta-1,4,6-triene;2-ethylguanidine |
|---|---|
| PubChem CID | 143157332 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (3Z,4Z,6Z)-4-ethenyl-3-ethylideneocta-1,4,6-triene;2-ethylguanidine |
| SMILES | C=CC(=C/C=C\C)/C(C=C)=C\C.CCN=C(N)N |
| InChI | InChI=1S/C12H16.C3H9N3/c1-5-9-10-12(8-4)11(6-2)7-3;1-2-6-3(4)5/h5-10H,2,4H2,1,3H3;2H2,1H3,(H4,4,5,6)/b9-5-,11-7-,12-10-; |
| InChIKey | ODDZTVHDQWFXSH-CJTXUHCASA-N |
| XLogP | 3.09 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|