About N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine
N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine (PubChem CID 143157755) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine.
Molecular Properties
| Compound Name | N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine |
| PubChem CID | 143157755 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine |
| SMILES | C=NC(=C)C1=NC=CCC1 |
| InChI | InChI=1S/C8H10N2/c1-7(9-2)8-5-3-4-6-10-8/h4,6H,1-3,5H2 |
| InChIKey | ZAESZUKTDZVJRG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine?
The IUPAC name of N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine (CID 143157755) is N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine.
What is the SMILES notation for N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine?
The canonical SMILES for N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine is C=NC(=C)C1=NC=CCC1.
What is the InChIKey of N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine?
The InChIKey is ZAESZUKTDZVJRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-7(9-2)8-5-3-4-6-10-8/h4,6H,1-3,5H2.
What are the key properties of N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine?
N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine has a molecular weight of 134.18 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-dihydropyridin-2-yl)ethenyl]methanimine is sourced from PubChem (CID 143157755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).