C15H24 — CID 143157763
1-buta-1,3-dien-2-ylcyclohexa-1,3-diene;ethane;prop-1-ene (PubChem CID 143157763) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-ylcyclohexa-1,3-diene;ethane;prop-1-ene.
| Compound Name | 1-buta-1,3-dien-2-ylcyclohexa-1,3-diene;ethane;prop-1-ene |
|---|---|
| PubChem CID | 143157763 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 1-buta-1,3-dien-2-ylcyclohexa-1,3-diene;ethane;prop-1-ene |
| SMILES | C=CC.C=CC(=C)C1=CC=CCC1.CC |
| InChI | InChI=1S/C10H12.C3H6.C2H6/c1-3-9(2)10-7-5-4-6-8-10;1-3-2;1-2/h3-5,7H,1-2,6,8H2;3H,1H2,2H3;1-2H3 |
| InChIKey | PXFBJPVBCBALAP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|