About 3,4-bis(ethenyl)-2,5-dihydrofuran
3,4-bis(ethenyl)-2,5-dihydrofuran (PubChem CID 143157899) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 3,4-bis(ethenyl)-2,5-dihydrofuran |
| PubChem CID | 143157899 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 3,4-bis(ethenyl)-2,5-dihydrofuran |
| SMILES | C=CC1=C(C=C)COC1 |
| InChI | InChI=1S/C8H10O/c1-3-7-5-9-6-8(7)4-2/h3-4H,1-2,5-6H2 |
| InChIKey | DLIUIWSMIMVGLC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-bis(ethenyl)-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(ethenyl)-2,5-dihydrofuran?
The IUPAC name of 3,4-bis(ethenyl)-2,5-dihydrofuran (CID 143157899) is 3,4-bis(ethenyl)-2,5-dihydrofuran.
What is the SMILES notation for 3,4-bis(ethenyl)-2,5-dihydrofuran?
The canonical SMILES for 3,4-bis(ethenyl)-2,5-dihydrofuran is C=CC1=C(C=C)COC1.
What is the InChIKey of 3,4-bis(ethenyl)-2,5-dihydrofuran?
The InChIKey is DLIUIWSMIMVGLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-3-7-5-9-6-8(7)4-2/h3-4H,1-2,5-6H2.
What are the key properties of 3,4-bis(ethenyl)-2,5-dihydrofuran?
3,4-bis(ethenyl)-2,5-dihydrofuran has a molecular weight of 122.17 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(ethenyl)-2,5-dihydrofuran is sourced from PubChem (CID 143157899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).