C14H22 — CID 143157913
ethane;1,2,3,4,5,8-hexahydroheptalene (PubChem CID 143157913) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is ethane;1,2,3,4,5,8-hexahydroheptalene.
| Compound Name | ethane;1,2,3,4,5,8-hexahydroheptalene |
|---|---|
| PubChem CID | 143157913 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | ethane;1,2,3,4,5,8-hexahydroheptalene |
| SMILES | C1=CC2=C(C=CC1)CCCCC2.CC |
| InChI | InChI=1S/C12H16.C2H6/c1-3-7-11-9-5-2-6-10-12(11)8-4-1;1-2/h3-4,7-8H,1-2,5-6,9-10H2;1-2H3 |
| InChIKey | LSPVBEAJLXDKEJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |