C11H16N2 — CID 143158039
7-methyl-6,7,8,9-tetrahydro-3H-2-benzazepin-1-amine (PubChem CID 143158039) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 7-methyl-6,7,8,9-tetrahydro-3H-2-benzazepin-1-amine.
| Compound Name | 7-methyl-6,7,8,9-tetrahydro-3H-2-benzazepin-1-amine |
|---|---|
| PubChem CID | 143158039 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 7-methyl-6,7,8,9-tetrahydro-3H-2-benzazepin-1-amine |
| SMILES | CC1CCC2=C(C=CCN=C2N)C1 |
| InChI | InChI=1S/C11H16N2/c1-8-4-5-10-9(7-8)3-2-6-13-11(10)12/h2-3,8H,4-7H2,1H3,(H2,12,13) |
| InChIKey | BIGKCRAXZOMYDI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |