C19H24ClNO — CID 143158267
N-[2-(3-chlorophenyl)ethyl]-3-ethylbenzamide;ethane (PubChem CID 143158267) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-3-ethylbenzamide;ethane.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-3-ethylbenzamide;ethane |
|---|---|
| PubChem CID | 143158267 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-3-ethylbenzamide;ethane |
| SMILES | CC.CCc1cccc(C(=O)NCCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H18ClNO.C2H6/c1-2-13-5-3-7-15(11-13)17(20)19-10-9-14-6-4-8-16(18)12-14;1-2/h3-8,11-12H,2,9-10H2,1H3,(H,19,20);1-2H3 |
| InChIKey | UYVBIYNOCPTPLF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |