About N,3-dimethylbut-2-enethioamide;ethane
N,3-dimethylbut-2-enethioamide;ethane (PubChem CID 143158413) has the molecular formula C8H17NS
and a molecular weight of 159.30 g/mol. Its IUPAC name is N,3-dimethylbut-2-enethioamide;ethane.
Molecular Properties
| Compound Name | N,3-dimethylbut-2-enethioamide;ethane |
| PubChem CID | 143158413 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | N,3-dimethylbut-2-enethioamide;ethane |
| SMILES | CC.CNC(=S)C=C(C)C |
| InChI | InChI=1S/C6H11NS.C2H6/c1-5(2)4-6(8)7-3;1-2/h4H,1-3H3,(H,7,8);1-2H3 |
| InChIKey | OMOJJTLGROTRQA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethylbut-2-enethioamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethylbut-2-enethioamide;ethane?
The IUPAC name of N,3-dimethylbut-2-enethioamide;ethane (CID 143158413) is N,3-dimethylbut-2-enethioamide;ethane.
What is the SMILES notation for N,3-dimethylbut-2-enethioamide;ethane?
The canonical SMILES for N,3-dimethylbut-2-enethioamide;ethane is CC.CNC(=S)C=C(C)C.
What is the InChIKey of N,3-dimethylbut-2-enethioamide;ethane?
The InChIKey is OMOJJTLGROTRQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NS.C2H6/c1-5(2)4-6(8)7-3;1-2/h4H,1-3H3,(H,7,8);1-2H3.
What are the key properties of N,3-dimethylbut-2-enethioamide;ethane?
N,3-dimethylbut-2-enethioamide;ethane has a molecular weight of 159.30 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethylbut-2-enethioamide;ethane is sourced from PubChem (CID 143158413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).