C24H39FO2 — CID 143159220
2-tert-butyl-3-(5-fluoro-2,3,3,6,6-pentamethylheptan-2-yl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 143159220) has the molecular formula C24H39FO2 and a molecular weight of 378.57 g/mol. Its IUPAC name is 2-tert-butyl-3-(5-fluoro-2,3,3,6,6-pentamethylheptan-2-yl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 2-tert-butyl-3-(5-fluoro-2,3,3,6,6-pentamethylheptan-2-yl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 143159220 |
| Molecular Formula | C24H39FO2 |
| Molecular Weight | 378.57 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | 2-tert-butyl-3-(5-fluoro-2,3,3,6,6-pentamethylheptan-2-yl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC(C)(C)C(F)CC(C)(C)C(C)(C)C1Oc2ccccc2OC1C(C)(C)C |
| InChI | InChI=1S/C24H39FO2/c1-21(2,3)18(25)15-23(7,8)24(9,10)20-19(22(4,5)6)26-16-13-11-12-14-17(16)27-20/h11-14,18-20H,15H2,1-10H3 |
| InChIKey | ACEBTOVRXXMPTN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.57 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |