C18H28N2O3S — CID 143159360
ethane;methoxyethane;4-(4-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carbaldehyde (PubChem CID 143159360) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is ethane;methoxyethane;4-(4-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carbaldehyde.
| Compound Name | ethane;methoxyethane;4-(4-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 143159360 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | ethane;methoxyethane;4-(4-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carbaldehyde |
| SMILES | CC.CCOC.COc1ccc(C2NC(=S)NC(C)=C2C=O)cc1 |
| InChI | InChI=1S/C13H14N2O2S.C3H8O.C2H6/c1-8-11(7-16)12(15-13(18)14-8)9-3-5-10(17-2)6-4-9;1-3-4-2;1-2/h3-7,12H,1-2H3,(H2,14,15,18);3H2,1-2H3;1-2H3 |
| InChIKey | IMDCDRFYUVSEAZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|