C36H45FN2O — CID 143159453
ethane;3-fluoro-N-methylaniline;3-methyl-4-[3-[(3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]cyclopentyl]benzaldehyde (PubChem CID 143159453) has the molecular formula C36H45FN2O and a molecular weight of 540.77 g/mol. Its IUPAC name is ethane;3-fluoro-N-methylaniline;3-methyl-4-[3-[(3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]cyclopentyl]benzaldehyde.
| Compound Name | ethane;3-fluoro-N-methylaniline;3-methyl-4-[3-[(3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]cyclopentyl]benzaldehyde |
|---|---|
| PubChem CID | 143159453 |
| Molecular Formula | C36H45FN2O |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | ethane;3-fluoro-N-methylaniline;3-methyl-4-[3-[(3'R)-3'-methylspiro[indene-1,4'-piperidine]-1'-yl]cyclopentyl]benzaldehyde |
| SMILES | CC.CNc1cccc(F)c1.Cc1cc(C=O)ccc1C1CCC(N2CCC3(C=Cc4ccccc43)[C@@H](C)C2)C1 |
| InChI | InChI=1S/C27H31NO.C7H8FN.C2H6/c1-19-15-21(18-29)7-10-25(19)23-8-9-24(16-23)28-14-13-27(20(2)17-28)12-11-22-5-3-4-6-26(22)27;1-9-7-4-2-3-6(8)5-7;1-2/h3-7,10-12,15,18,20,23-24H,8-9,13-14,16-17H2,1-2H3;2-5,9H,1H3;1-2H3/t20-,23?,24?,27?;;/m0../s1 |
| InChIKey | YYXHVSKKCVCZOL-ZHAQZNGSSA-N |
| XLogP | 8.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|