C27H44BNO4 — CID 143159504
4-[(Z)-11-methoxy-5,7-dimethyl-11-(6-methylhept-6-enylideneboranyl)-4-oxoundec-7-enyl]piperidine-2,6-dione (PubChem CID 143159504) has the molecular formula C27H44BNO4 and a molecular weight of 457.46 g/mol. Its IUPAC name is 4-[(Z)-11-methoxy-5,7-dimethyl-11-(6-methylhept-6-enylideneboranyl)-4-oxoundec-7-enyl]piperidine-2,6-dione.
| Compound Name | 4-[(Z)-11-methoxy-5,7-dimethyl-11-(6-methylhept-6-enylideneboranyl)-4-oxoundec-7-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 143159504 |
| Molecular Formula | C27H44BNO4 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.34 |
| IUPAC Name | 4-[(Z)-11-methoxy-5,7-dimethyl-11-(6-methylhept-6-enylideneboranyl)-4-oxoundec-7-enyl]piperidine-2,6-dione |
| SMILES | C=C(C)CCCC/C=B/C(CC/C=C(/C)CC(C)C(=O)CCCC1CC(=O)NC(=O)C1)OC |
| InChI | InChI=1S/C27H44BNO4/c1-20(2)11-7-6-8-16-28-25(33-5)15-9-12-21(3)17-22(4)24(30)14-10-13-23-18-26(31)29-27(32)19-23/h12,16,22-23,25H,1,6-11,13-15,17-19H2,2-5H3,(H,29,31,32)/b21-12- |
| InChIKey | PCDASPWBAOGKJF-MTJSOVHGSA-N |
| XLogP | 5.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|