C17H10F3N3O3S2 — CID 143159718
[5-(4-methylphenyl)-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfinate (PubChem CID 143159718) has the molecular formula C17H10F3N3O3S2 and a molecular weight of 425.41 g/mol. Its IUPAC name is [5-(4-methylphenyl)-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfinate.
| Compound Name | [5-(4-methylphenyl)-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfinate |
|---|---|
| PubChem CID | 143159718 |
| Molecular Formula | C17H10F3N3O3S2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | [5-(4-methylphenyl)-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl] trifluoromethanesulfinate |
| SMILES | Cc1ccc(-n2cnc3c(sc4nccc(OS(=O)C(F)(F)F)c43)c2=O)cc1 |
| InChI | InChI=1S/C17H10F3N3O3S2/c1-9-2-4-10(5-3-9)23-8-22-13-12-11(26-28(25)17(18,19)20)6-7-21-15(12)27-14(13)16(23)24/h2-8H,1H3 |
| InChIKey | ROHNIWLPQVZOSD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |