C19H24N4O2S — CID 143159822
13-(2-hydroxyethylamino)-4-methyl-5-(4-methylcyclohexyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 143159822) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 13-(2-hydroxyethylamino)-4-methyl-5-(4-methylcyclohexyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-(2-hydroxyethylamino)-4-methyl-5-(4-methylcyclohexyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 143159822 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 13-(2-hydroxyethylamino)-4-methyl-5-(4-methylcyclohexyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | Cc1nc2c(sc3nccc(NCCO)c32)c(=O)n1C1CCC(C)CC1 |
| InChI | InChI=1S/C19H24N4O2S/c1-11-3-5-13(6-4-11)23-12(2)22-16-15-14(20-9-10-24)7-8-21-18(15)26-17(16)19(23)25/h7-8,11,13,24H,3-6,9-10H2,1-2H3,(H,20,21) |
| InChIKey | CBTKNKRXNAXXDR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |