C12H12N4OS — CID 143159868
3-(dimethylamino)-8-thia-6,12,14-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6,12-pentaen-10-one (PubChem CID 143159868) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 3-(dimethylamino)-8-thia-6,12,14-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6,12-pentaen-10-one.
| Compound Name | 3-(dimethylamino)-8-thia-6,12,14-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6,12-pentaen-10-one |
|---|---|
| PubChem CID | 143159868 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-(dimethylamino)-8-thia-6,12,14-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6,12-pentaen-10-one |
| SMILES | CN(C)c1ccnc2sc3c(c12)NC=NCC3=O |
| InChI | InChI=1S/C12H12N4OS/c1-16(2)7-3-4-14-12-9(7)10-11(18-12)8(17)5-13-6-15-10/h3-4,6H,5H2,1-2H3,(H,13,15) |
| InChIKey | LVDQVHBUNZSUJX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |