C12H12N2OS — CID 143159940
4-(cyclobutylamino)thieno[2,3-b]pyridine-2-carbaldehyde (PubChem CID 143159940) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is 4-(cyclobutylamino)thieno[2,3-b]pyridine-2-carbaldehyde.
| Compound Name | 4-(cyclobutylamino)thieno[2,3-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 143159940 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-(cyclobutylamino)thieno[2,3-b]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc2c(NC3CCC3)ccnc2s1 |
| InChI | InChI=1S/C12H12N2OS/c15-7-9-6-10-11(14-8-2-1-3-8)4-5-13-12(10)16-9/h4-8H,1-3H2,(H,13,14) |
| InChIKey | ZWDMNOTZNLANHI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|