C23H27N5OS — CID 143159955
N-[(2E,5Z)-6-(buta-1,3-dien-2-ylamino)-4-methylidenehexa-2,5-dien-2-yl]-N-[[4-(dimethylamino)-2-methylthieno[2,3-b]pyridin-3-yl]iminomethyl]formamide (PubChem CID 143159955) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is N-[(2E,5Z)-6-(buta-1,3-dien-2-ylamino)-4-methylidenehexa-2,5-dien-2-yl]-N-[[4-(dimethylamino)-2-methylthieno[2,3-b]pyridin-3-yl]iminomethyl]formamide.
| Compound Name | N-[(2E,5Z)-6-(buta-1,3-dien-2-ylamino)-4-methylidenehexa-2,5-dien-2-yl]-N-[[4-(dimethylamino)-2-methylthieno[2,3-b]pyridin-3-yl]iminomethyl]formamide |
|---|---|
| PubChem CID | 143159955 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[(2E,5Z)-6-(buta-1,3-dien-2-ylamino)-4-methylidenehexa-2,5-dien-2-yl]-N-[[4-(dimethylamino)-2-methylthieno[2,3-b]pyridin-3-yl]iminomethyl]formamide |
| SMILES | C=CC(=C)N/C=C\C(=C)/C=C(\C)N(C=O)/C=N/c1c(C)sc2nccc(N(C)C)c12 |
| InChI | InChI=1S/C23H27N5OS/c1-8-17(3)24-11-9-16(2)13-18(4)28(15-29)14-26-22-19(5)30-23-21(22)20(27(6)7)10-12-25-23/h8-15,24H,1-3H2,4-7H3/b11-9-,18-13+,26-14+ |
| InChIKey | VVEJDQFMVKKUIH-GWRWEIFQSA-N |
| XLogP | 5.05 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|