C25H36N4OS — CID 143160020
ethane;N'-methyl-N-[(2Z,5Z)-5-methylhepta-2,5-dienyl]-N-[2-[4-[methyl(prop-2-enyl)amino]thieno[2,3-b]pyridin-2-yl]-2-oxoethyl]methanimidamide (PubChem CID 143160020) has the molecular formula C25H36N4OS and a molecular weight of 440.66 g/mol. Its IUPAC name is ethane;N'-methyl-N-[(2Z,5Z)-5-methylhepta-2,5-dienyl]-N-[2-[4-[methyl(prop-2-enyl)amino]thieno[2,3-b]pyridin-2-yl]-2-oxoethyl]methanimidamide.
| Compound Name | ethane;N'-methyl-N-[(2Z,5Z)-5-methylhepta-2,5-dienyl]-N-[2-[4-[methyl(prop-2-enyl)amino]thieno[2,3-b]pyridin-2-yl]-2-oxoethyl]methanimidamide |
|---|---|
| PubChem CID | 143160020 |
| Molecular Formula | C25H36N4OS |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | ethane;N'-methyl-N-[(2Z,5Z)-5-methylhepta-2,5-dienyl]-N-[2-[4-[methyl(prop-2-enyl)amino]thieno[2,3-b]pyridin-2-yl]-2-oxoethyl]methanimidamide |
| SMILES | C=CCN(C)c1ccnc2sc(C(=O)CN(/C=N/C)C/C=C\C/C(C)=C\C)cc12.CC |
| InChI | InChI=1S/C23H30N4OS.C2H6/c1-6-13-26(5)20-11-12-25-23-19(20)15-22(29-23)21(28)16-27(17-24-4)14-9-8-10-18(3)7-2;1-2/h6-9,11-12,15,17H,1,10,13-14,16H2,2-5H3;1-2H3/b9-8-,18-7-,24-17+; |
| InChIKey | HIIMRXXPSBHGSR-PMOBRRBMSA-N |
| XLogP | 6.00 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|