C19H22N4OS — CID 143160095
13-(methylamino)-5-[(3E,5Z)-nona-3,5-dien-4-yl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 143160095) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 13-(methylamino)-5-[(3E,5Z)-nona-3,5-dien-4-yl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-(methylamino)-5-[(3E,5Z)-nona-3,5-dien-4-yl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 143160095 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 13-(methylamino)-5-[(3E,5Z)-nona-3,5-dien-4-yl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | CC/C=C(\C=C/CCC)n1cnc2c(sc3nccc(NC)c32)c1=O |
| InChI | InChI=1S/C19H22N4OS/c1-4-6-7-9-13(8-5-2)23-12-22-16-15-14(20-3)10-11-21-18(15)25-17(16)19(23)24/h7-12H,4-6H2,1-3H3,(H,20,21)/b9-7-,13-8+ |
| InChIKey | XFMWIUMGNUGDBD-OKFFXAGVSA-N |
| XLogP | 4.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|