C23H26N4O3S — CID 143160165
N-(5-octan-3-yl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl)-4H-pyran-2-carboxamide (PubChem CID 143160165) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-(5-octan-3-yl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl)-4H-pyran-2-carboxamide.
| Compound Name | N-(5-octan-3-yl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl)-4H-pyran-2-carboxamide |
|---|---|
| PubChem CID | 143160165 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-(5-octan-3-yl-6-oxo-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-13-yl)-4H-pyran-2-carboxamide |
| SMILES | CCCCCC(CC)n1cnc2c(sc3nccc(NC(=O)C4=CCC=CO4)c32)c1=O |
| InChI | InChI=1S/C23H26N4O3S/c1-3-5-6-9-15(4-2)27-14-25-19-18-16(26-21(28)17-10-7-8-13-30-17)11-12-24-22(18)31-20(19)23(27)29/h8,10-15H,3-7,9H2,1-2H3,(H,24,26,28) |
| InChIKey | QWFVUEDJDXSRKJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|