C18H22N4OS — CID 143160479
N'-[4-(ethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-methylmethanimidamide (PubChem CID 143160479) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is N'-[4-(ethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-methylmethanimidamide.
| Compound Name | N'-[4-(ethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 143160479 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N'-[4-(ethylamino)-2-formylthieno[2,3-b]pyridin-3-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-methylmethanimidamide |
| SMILES | C/C=C\C(=C/C)N(C)/C=N/c1c(C=O)sc2nccc(NCC)c12 |
| InChI | InChI=1S/C18H22N4OS/c1-5-8-13(6-2)22(4)12-21-17-15(11-23)24-18-16(17)14(19-7-3)9-10-20-18/h5-6,8-12H,7H2,1-4H3,(H,19,20)/b8-5-,13-6+,21-12+ |
| InChIKey | OBDMENUAHHLUPF-CTJQLEJYSA-N |
| XLogP | 4.61 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|