C20H21FN4O2S — CID 143160532
13-(dimethylamino)-5-[(2E,4Z)-4-fluoro-5-methoxyhepta-2,4,6-trien-2-yl]-11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 143160532) has the molecular formula C20H21FN4O2S and a molecular weight of 400.48 g/mol. Its IUPAC name is 13-(dimethylamino)-5-[(2E,4Z)-4-fluoro-5-methoxyhepta-2,4,6-trien-2-yl]-11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-(dimethylamino)-5-[(2E,4Z)-4-fluoro-5-methoxyhepta-2,4,6-trien-2-yl]-11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 143160532 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 13-(dimethylamino)-5-[(2E,4Z)-4-fluoro-5-methoxyhepta-2,4,6-trien-2-yl]-11-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | C=C/C(OC)=C(F)\C=C(/C)n1cnc2c(sc3nc(C)cc(N(C)C)c32)c1=O |
| InChI | InChI=1S/C20H21FN4O2S/c1-7-15(27-6)13(21)9-12(3)25-10-22-17-16-14(24(4)5)8-11(2)23-19(16)28-18(17)20(25)26/h7-10H,1H2,2-6H3/b12-9+,15-13- |
| InChIKey | IQIVMKYTPQSYRD-JFPQFWRGSA-N |
| XLogP | 4.25 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|