About ethane;2-propan-2-ylpyridazin-3-one
ethane;2-propan-2-ylpyridazin-3-one (PubChem CID 143160773) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is ethane;2-propan-2-ylpyridazin-3-one.
Molecular Properties
| Compound Name | ethane;2-propan-2-ylpyridazin-3-one |
| PubChem CID | 143160773 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | ethane;2-propan-2-ylpyridazin-3-one |
| SMILES | CC.CC(C)n1ncccc1=O |
| InChI | InChI=1S/C7H10N2O.C2H6/c1-6(2)9-7(10)4-3-5-8-9;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | HNUBXHWPVGWNKX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-propan-2-ylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-propan-2-ylpyridazin-3-one?
The IUPAC name of ethane;2-propan-2-ylpyridazin-3-one (CID 143160773) is ethane;2-propan-2-ylpyridazin-3-one.
What is the SMILES notation for ethane;2-propan-2-ylpyridazin-3-one?
The canonical SMILES for ethane;2-propan-2-ylpyridazin-3-one is CC.CC(C)n1ncccc1=O.
What is the InChIKey of ethane;2-propan-2-ylpyridazin-3-one?
The InChIKey is HNUBXHWPVGWNKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O.C2H6/c1-6(2)9-7(10)4-3-5-8-9;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of ethane;2-propan-2-ylpyridazin-3-one?
ethane;2-propan-2-ylpyridazin-3-one has a molecular weight of 168.24 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-propan-2-ylpyridazin-3-one is sourced from PubChem (CID 143160773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).