C18H26F3NO2 — CID 143161339
tert-butyl formate;1,7-dimethyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine (PubChem CID 143161339) has the molecular formula C18H26F3NO2 and a molecular weight of 345.41 g/mol. Its IUPAC name is tert-butyl formate;1,7-dimethyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | tert-butyl formate;1,7-dimethyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 143161339 |
| Molecular Formula | C18H26F3NO2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | tert-butyl formate;1,7-dimethyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepine |
| SMILES | CC(C)(C)OC=O.Cc1cc2c(cc1C(F)(F)F)N(C)CCCC2 |
| InChI | InChI=1S/C13H16F3N.C5H10O2/c1-9-7-10-5-3-4-6-17(2)12(10)8-11(9)13(14,15)16;1-5(2,3)7-4-6/h7-8H,3-6H2,1-2H3;4H,1-3H3 |
| InChIKey | NHZKHIKTJZMYPX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|