C10H12F6 — CID 143161376
(2E,4Z)-1,1,1,7,7,7-hexafluoro-2,4,6-trimethylhepta-2,4-diene (PubChem CID 143161376) has the molecular formula C10H12F6 and a molecular weight of 246.19 g/mol. Its IUPAC name is (2E,4Z)-1,1,1,7,7,7-hexafluoro-2,4,6-trimethylhepta-2,4-diene.
| Compound Name | (2E,4Z)-1,1,1,7,7,7-hexafluoro-2,4,6-trimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 143161376 |
| Molecular Formula | C10H12F6 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (2E,4Z)-1,1,1,7,7,7-hexafluoro-2,4,6-trimethylhepta-2,4-diene |
| SMILES | CC(=C/C(C)C(F)(F)F)/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C10H12F6/c1-6(4-7(2)9(11,12)13)5-8(3)10(14,15)16/h4-5,7H,1-3H3/b6-4-,8-5+ |
| InChIKey | NIGYYZPUQHDFBF-QXMOYCCXSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|