C22H25ClO3 — CID 143162307
2-[(2E,4E)-5-chloro-4-[(4-ethynylphenyl)methyl]hepta-2,4,6-trien-2-yl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 143162307) has the molecular formula C22H25ClO3 and a molecular weight of 372.89 g/mol. Its IUPAC name is 2-[(2E,4E)-5-chloro-4-[(4-ethynylphenyl)methyl]hepta-2,4,6-trien-2-yl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[(2E,4E)-5-chloro-4-[(4-ethynylphenyl)methyl]hepta-2,4,6-trien-2-yl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 143162307 |
| Molecular Formula | C22H25ClO3 |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-[(2E,4E)-5-chloro-4-[(4-ethynylphenyl)methyl]hepta-2,4,6-trien-2-yl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | C#Cc1ccc(CC(/C=C(\C)C2CC(O)CC(CO)O2)=C(\Cl)C=C)cc1 |
| InChI | InChI=1S/C22H25ClO3/c1-4-16-6-8-17(9-7-16)11-18(21(23)5-2)10-15(3)22-13-19(25)12-20(14-24)26-22/h1,5-10,19-20,22,24-25H,2,11-14H2,3H3/b15-10+,21-18- |
| InChIKey | NAAPBOAFMCFGHA-XYGVBGMQSA-N |
| XLogP | 3.74 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|