About (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane
(4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane (PubChem CID 143162572) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane.
Molecular Properties
| Compound Name | (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane |
| PubChem CID | 143162572 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane |
| SMILES | C/C=c1/c(C)ns/c1=C/C.CC |
| InChI | InChI=1S/C8H11NS.C2H6/c1-4-7-6(3)9-10-8(7)5-2;1-2/h4-5H,1-3H3;1-2H3/b7-4-,8-5+; |
| InChIKey | ZLOPOQNPXLEUQZ-QMKOBIDDSA-N |
| XLogP | 2.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane?
The IUPAC name of (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane (CID 143162572) is (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane.
What is the SMILES notation for (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane?
The canonical SMILES for (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane is C/C=c1/c(C)ns/c1=C/C.CC.
What is the InChIKey of (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane?
The InChIKey is ZLOPOQNPXLEUQZ-QMKOBIDDSA-N. The full InChI is InChI=1S/C8H11NS.C2H6/c1-4-7-6(3)9-10-8(7)5-2;1-2/h4-5H,1-3H3;1-2H3/b7-4-,8-5+;.
What are the key properties of (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane?
(4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane has a molecular weight of 183.32 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,5E)-4,5-di(ethylidene)-3-methyl-1,2-thiazole;ethane is sourced from PubChem (CID 143162572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).