About ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole
ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole (PubChem CID 143162666) has the molecular formula C11H13NS
and a molecular weight of 191.30 g/mol. Its IUPAC name is ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole.
Molecular Properties
| Compound Name | ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole |
| PubChem CID | 143162666 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole |
| SMILES | C=C.Cc1nsc2c1=CC1CC1C=2 |
| InChI | InChI=1S/C9H9NS.C2H4/c1-5-8-3-6-2-7(6)4-9(8)11-10-5;1-2/h3-4,6-7H,2H2,1H3;1-2H2 |
| InChIKey | XQQXTVOKKCETKT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole?
The IUPAC name of ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole (CID 143162666) is ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole.
What is the SMILES notation for ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole?
The canonical SMILES for ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole is C=C.Cc1nsc2c1=CC1CC1C=2.
What is the InChIKey of ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole?
The InChIKey is XQQXTVOKKCETKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS.C2H4/c1-5-8-3-6-2-7(6)4-9(8)11-10-5;1-2/h3-4,6-7H,2H2,1H3;1-2H2.
What are the key properties of ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole?
ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole has a molecular weight of 191.30 g/mol, XLogP of 1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;3-methyl-5,5a-dihydro-4aH-cyclopropa[f][1,2]benzothiazole is sourced from PubChem (CID 143162666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).