C17H36N4O2 — CID 143162791
tert-butyl N-(1-methylpiperidin-4-yl)carbamate;2,5-dimethylpiperazine (PubChem CID 143162791) has the molecular formula C17H36N4O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is tert-butyl N-(1-methylpiperidin-4-yl)carbamate;2,5-dimethylpiperazine.
| Compound Name | tert-butyl N-(1-methylpiperidin-4-yl)carbamate;2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 143162791 |
| Molecular Formula | C17H36N4O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | tert-butyl N-(1-methylpiperidin-4-yl)carbamate;2,5-dimethylpiperazine |
| SMILES | CC1CNC(C)CN1.CN1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C11H22N2O2.C6H14N2/c1-11(2,3)15-10(14)12-9-5-7-13(4)8-6-9;1-5-3-8-6(2)4-7-5/h9H,5-8H2,1-4H3,(H,12,14);5-8H,3-4H2,1-2H3 |
| InChIKey | MBGPWJQCTAHWRB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |