C17H18ClN3OS4 — CID 143162909
2-chloro-N-[2-piperidin-4-yl-3,4,5,6-tetrakis(sulfanyl)phenyl]pyridine-4-carboxamide (PubChem CID 143162909) has the molecular formula C17H18ClN3OS4 and a molecular weight of 444.07 g/mol. Its IUPAC name is 2-chloro-N-[2-piperidin-4-yl-3,4,5,6-tetrakis(sulfanyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-piperidin-4-yl-3,4,5,6-tetrakis(sulfanyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 143162909 |
| Molecular Formula | C17H18ClN3OS4 |
| Molecular Weight | 444.07 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 2-chloro-N-[2-piperidin-4-yl-3,4,5,6-tetrakis(sulfanyl)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1c(S)c(S)c(S)c(S)c1C1CCNCC1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3OS4/c18-10-7-9(3-6-20-10)17(22)21-12-11(8-1-4-19-5-2-8)13(23)15(25)16(26)14(12)24/h3,6-8,19,23-26H,1-2,4-5H2,(H,21,22) |
| InChIKey | IZRLPZVAGCMTPM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.07 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|