C24H33ClN2 — CID 143162915
2-[1-[(E)-3-(5-chlorocyclohepta-1,6-dien-1-yl)prop-2-enyl]-3,6-dihydro-2H-pyridin-4-yl]-4-methylaniline;ethane (PubChem CID 143162915) has the molecular formula C24H33ClN2 and a molecular weight of 385.00 g/mol. Its IUPAC name is 2-[1-[(E)-3-(5-chlorocyclohepta-1,6-dien-1-yl)prop-2-enyl]-3,6-dihydro-2H-pyridin-4-yl]-4-methylaniline;ethane.
| Compound Name | 2-[1-[(E)-3-(5-chlorocyclohepta-1,6-dien-1-yl)prop-2-enyl]-3,6-dihydro-2H-pyridin-4-yl]-4-methylaniline;ethane |
|---|---|
| PubChem CID | 143162915 |
| Molecular Formula | C24H33ClN2 |
| Molecular Weight | 385.00 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-[1-[(E)-3-(5-chlorocyclohepta-1,6-dien-1-yl)prop-2-enyl]-3,6-dihydro-2H-pyridin-4-yl]-4-methylaniline;ethane |
| SMILES | CC.Cc1ccc(N)c(C2=CCN(C/C=C/C3=CCCC(Cl)C=C3)CC2)c1 |
| InChI | InChI=1S/C22H27ClN2.C2H6/c1-17-7-10-22(24)21(16-17)19-11-14-25(15-12-19)13-3-5-18-4-2-6-20(23)9-8-18;1-2/h3-5,7-11,16,20H,2,6,12-15,24H2,1H3;1-2H3/b5-3+; |
| InChIKey | NJVWGXCCEMUWBC-WGCWOXMQSA-N |
| XLogP | 6.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.00 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|