C19H27FN6O — CID 143163710
N-[(2E)-2-[5-(4-amino-2-fluorophenoxy)-1-ethenyl-1,2,4-triazin-6-ylidene]propyl]-N'-ethyl-N'-methylethane-1,2-diamine (PubChem CID 143163710) has the molecular formula C19H27FN6O and a molecular weight of 374.46 g/mol. Its IUPAC name is N-[(2E)-2-[5-(4-amino-2-fluorophenoxy)-1-ethenyl-1,2,4-triazin-6-ylidene]propyl]-N'-ethyl-N'-methylethane-1,2-diamine.
| Compound Name | N-[(2E)-2-[5-(4-amino-2-fluorophenoxy)-1-ethenyl-1,2,4-triazin-6-ylidene]propyl]-N'-ethyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 143163710 |
| Molecular Formula | C19H27FN6O |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | N-[(2E)-2-[5-(4-amino-2-fluorophenoxy)-1-ethenyl-1,2,4-triazin-6-ylidene]propyl]-N'-ethyl-N'-methylethane-1,2-diamine |
| SMILES | C=CN1N=CN=C(Oc2ccc(N)cc2F)/C1=C(/C)CNCCN(C)CC |
| InChI | InChI=1S/C19H27FN6O/c1-5-25(4)10-9-22-12-14(3)18-19(23-13-24-26(18)6-2)27-17-8-7-15(21)11-16(17)20/h6-8,11,13,22H,2,5,9-10,12,21H2,1,3-4H3/b18-14+ |
| InChIKey | DSLBRXIVJJSHAU-NBVRZTHBSA-N |
| XLogP | 2.40 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|