C27H36N4O3 — CID 143163779
but-3-enal;6-[(E)-but-2-en-2-yl]-N-[[(2S)-oxolan-2-yl]methyl]-5-phenylfuro[2,3-d]pyrimidin-4-amine;N-methylmethanamine (PubChem CID 143163779) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is but-3-enal;6-[(E)-but-2-en-2-yl]-N-[[(2S)-oxolan-2-yl]methyl]-5-phenylfuro[2,3-d]pyrimidin-4-amine;N-methylmethanamine.
| Compound Name | but-3-enal;6-[(E)-but-2-en-2-yl]-N-[[(2S)-oxolan-2-yl]methyl]-5-phenylfuro[2,3-d]pyrimidin-4-amine;N-methylmethanamine |
|---|---|
| PubChem CID | 143163779 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | but-3-enal;6-[(E)-but-2-en-2-yl]-N-[[(2S)-oxolan-2-yl]methyl]-5-phenylfuro[2,3-d]pyrimidin-4-amine;N-methylmethanamine |
| SMILES | C/C=C(\C)c1oc2ncnc(NC[C@@H]3CCCO3)c2c1-c1ccccc1.C=CCC=O.CNC |
| InChI | InChI=1S/C21H23N3O2.C4H6O.C2H7N/c1-3-14(2)19-17(15-8-5-4-6-9-15)18-20(23-13-24-21(18)26-19)22-12-16-10-7-11-25-16;1-2-3-4-5;1-3-2/h3-6,8-9,13,16H,7,10-12H2,1-2H3,(H,22,23,24);2,4H,1,3H2;3H,1-2H3/b14-3+;;/t16-;;/m0../s1 |
| InChIKey | LXRRCVPWDOEUQJ-UWZFMUMYSA-N |
| XLogP | 5.50 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|