C9H17NO — CID 143164410
(2E,4E)-5-aminohepta-2,4,6-trien-2-ol;ethane (PubChem CID 143164410) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (2E,4E)-5-aminohepta-2,4,6-trien-2-ol;ethane.
| Compound Name | (2E,4E)-5-aminohepta-2,4,6-trien-2-ol;ethane |
|---|---|
| PubChem CID | 143164410 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (2E,4E)-5-aminohepta-2,4,6-trien-2-ol;ethane |
| SMILES | C=C/C(N)=C\C=C(/C)O.CC |
| InChI | InChI=1S/C7H11NO.C2H6/c1-3-7(8)5-4-6(2)9;1-2/h3-5,9H,1,8H2,2H3;1-2H3/b6-4+,7-5+; |
| InChIKey | OTGYKBAAKVNSEP-GWDFKRKCSA-N |
| XLogP | 2.50 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|