C17H11NO4S — CID 143165047
5,12-dioxo-3,4-dihydro-2H-naphtho[3,2-g][1,4]benzothiazine-8-carboxylic acid (PubChem CID 143165047) has the molecular formula C17H11NO4S and a molecular weight of 325.35 g/mol. Its IUPAC name is 5,12-dioxo-3,4-dihydro-2H-naphtho[3,2-g][1,4]benzothiazine-8-carboxylic acid.
| Compound Name | 5,12-dioxo-3,4-dihydro-2H-naphtho[3,2-g][1,4]benzothiazine-8-carboxylic acid |
|---|---|
| PubChem CID | 143165047 |
| Molecular Formula | C17H11NO4S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 5,12-dioxo-3,4-dihydro-2H-naphtho[3,2-g][1,4]benzothiazine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2cc3c(cc2c1)C(=O)C1=C(SCCN1)C3=O |
| InChI | InChI=1S/C17H11NO4S/c19-14-11-7-10-5-9(17(21)22)2-1-8(10)6-12(11)15(20)16-13(14)18-3-4-23-16/h1-2,5-7,18H,3-4H2,(H,21,22) |
| InChIKey | OAUGDSWFQUUVOK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|