C11H17NS — CID 143165209
5-[(1Z)-buta-1,3-dienyl]-2,4-dimethyl-1,3-thiazole;ethane (PubChem CID 143165209) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-2,4-dimethyl-1,3-thiazole;ethane.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-2,4-dimethyl-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 143165209 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-2,4-dimethyl-1,3-thiazole;ethane |
| SMILES | C=C/C=C\c1sc(C)nc1C.CC |
| InChI | InChI=1S/C9H11NS.C2H6/c1-4-5-6-9-7(2)10-8(3)11-9;1-2/h4-6H,1H2,2-3H3;1-2H3/b6-5-; |
| InChIKey | IBTFVFGCYFFPNX-YSMBQZINSA-N |
| XLogP | 3.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|