C20H18N2O2S — CID 143165547
(5Z)-5-[[2-phenyl-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 143165547) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is (5Z)-5-[[2-phenyl-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-phenyl-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 143165547 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (5Z)-5-[[2-phenyl-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C/C=C\c1[nH]c(-c2ccccc2)c(/C=C2\SC(=O)NC2=O)c1/C=C\C |
| InChI | InChI=1S/C20H18N2O2S/c1-3-8-14-15(12-17-19(23)22-20(24)25-17)18(21-16(14)9-4-2)13-10-6-5-7-11-13/h3-12,21H,1-2H3,(H,22,23,24)/b8-3-,9-4-,17-12- |
| InChIKey | ZZYNLFOLXWOOCG-GEHAFJSJSA-N |
| XLogP | 5.07 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|