C16H17F2N5O — CID 143165709
N'-diazenyl-1-[(2Z,4Z)-1,2-difluorohepta-2,4-dien-3-yl]oxyindole-5-carboximidamide (PubChem CID 143165709) has the molecular formula C16H17F2N5O and a molecular weight of 333.34 g/mol. Its IUPAC name is N'-diazenyl-1-[(2Z,4Z)-1,2-difluorohepta-2,4-dien-3-yl]oxyindole-5-carboximidamide.
| Compound Name | N'-diazenyl-1-[(2Z,4Z)-1,2-difluorohepta-2,4-dien-3-yl]oxyindole-5-carboximidamide |
|---|---|
| PubChem CID | 143165709 |
| Molecular Formula | C16H17F2N5O |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N'-diazenyl-1-[(2Z,4Z)-1,2-difluorohepta-2,4-dien-3-yl]oxyindole-5-carboximidamide |
| SMILES | [H]/N=N/N=C(N)c1ccc2c(ccn2OC(/C=C\CC)=C(\F)CF)c1 |
| InChI | InChI=1S/C16H17F2N5O/c1-2-3-4-15(13(18)10-17)24-23-8-7-11-9-12(5-6-14(11)23)16(19)21-22-20/h3-9H,2,10H2,1H3,(H3,19,20,21)/b4-3-,15-13- |
| InChIKey | FDZULZHXBWEIBT-VADLQIHFSA-N |
| XLogP | 3.84 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|