About 7-azaspiro[4.5]decane-4,7-diamine
7-azaspiro[4.5]decane-4,7-diamine (PubChem CID 143166126) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is 7-azaspiro[4.5]decane-4,7-diamine.
Molecular Properties
| Compound Name | 7-azaspiro[4.5]decane-4,7-diamine |
| PubChem CID | 143166126 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 7-azaspiro[4.5]decane-4,7-diamine |
| SMILES | NC1CCCC12CCCN(N)C2 |
| InChI | InChI=1S/C9H19N3/c10-8-3-1-4-9(8)5-2-6-12(11)7-9/h8H,1-7,10-11H2 |
| InChIKey | WPAADNBHBKJWQT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 7-azaspiro[4.5]decane-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azaspiro[4.5]decane-4,7-diamine?
The IUPAC name of 7-azaspiro[4.5]decane-4,7-diamine (CID 143166126) is 7-azaspiro[4.5]decane-4,7-diamine.
What is the SMILES notation for 7-azaspiro[4.5]decane-4,7-diamine?
The canonical SMILES for 7-azaspiro[4.5]decane-4,7-diamine is NC1CCCC12CCCN(N)C2.
What is the InChIKey of 7-azaspiro[4.5]decane-4,7-diamine?
The InChIKey is WPAADNBHBKJWQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3/c10-8-3-1-4-9(8)5-2-6-12(11)7-9/h8H,1-7,10-11H2.
What are the key properties of 7-azaspiro[4.5]decane-4,7-diamine?
7-azaspiro[4.5]decane-4,7-diamine has a molecular weight of 169.27 g/mol, XLogP of 0.45, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azaspiro[4.5]decane-4,7-diamine is sourced from PubChem (CID 143166126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).