C20H32O — CID 143166298
1-(3a,6-dimethyl-2,3,4,5,5a,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl)pentan-3-ol (PubChem CID 143166298) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-(3a,6-dimethyl-2,3,4,5,5a,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl)pentan-3-ol.
| Compound Name | 1-(3a,6-dimethyl-2,3,4,5,5a,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl)pentan-3-ol |
|---|---|
| PubChem CID | 143166298 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 1-(3a,6-dimethyl-2,3,4,5,5a,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl)pentan-3-ol |
| SMILES | CCC(O)CCC1(C)C=CC=C2C1CCC1(C)CCCC21 |
| InChI | InChI=1S/C20H32O/c1-4-15(21)9-13-19(2)11-5-7-16-17-8-6-12-20(17,3)14-10-18(16)19/h5,7,11,15,17-18,21H,4,6,8-10,12-14H2,1-3H3 |
| InChIKey | WBKBSGSUSYBRGH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |