C24H17ClF6N4O4 — CID 143166366
4-[3-chloro-5-(nitrosomethyl)-2-pyridinyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1,4-benzoxazine-8-carboxamide (PubChem CID 143166366) has the molecular formula C24H17ClF6N4O4 and a molecular weight of 574.87 g/mol. Its IUPAC name is 4-[3-chloro-5-(nitrosomethyl)-2-pyridinyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1,4-benzoxazine-8-carboxamide.
| Compound Name | 4-[3-chloro-5-(nitrosomethyl)-2-pyridinyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1,4-benzoxazine-8-carboxamide |
|---|---|
| PubChem CID | 143166366 |
| Molecular Formula | C24H17ClF6N4O4 |
| Molecular Weight | 574.87 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 4-[3-chloro-5-(nitrosomethyl)-2-pyridinyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1,4-benzoxazine-8-carboxamide |
| SMILES | O=NCc1cnc(N2CCOc3c(C(=O)Nc4ccc(C(O)(C(F)(F)F)C(F)(F)F)cc4)cccc32)c(Cl)c1 |
| InChI | InChI=1S/C24H17ClF6N4O4/c25-17-10-13(12-33-38)11-32-20(17)35-8-9-39-19-16(2-1-3-18(19)35)21(36)34-15-6-4-14(5-7-15)22(37,23(26,27)28)24(29,30)31/h1-7,10-11,37H,8-9,12H2,(H,34,36) |
| InChIKey | JNTHHFORLLGHTQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.87 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |