About CID 14316656
CID 14316656 (PubChem CID 14316656) has the molecular formula CBrCl2
and a molecular weight of 162.82 g/mol.
Molecular Properties
| Compound Name | CID 14316656 |
| PubChem CID | 14316656 |
| Molecular Formula | CBrCl2 |
| Molecular Weight | 162.82 g/mol |
| Exact Mass | 160.86 |
| IUPAC Name | — |
| SMILES | Cl[C](Cl)Br |
| InChI | InChI=1S/CBrCl2/c2-1(3)4 |
| InChIKey | IUYPEHPYBDZIAN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.82 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 14316656 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 14316656?
The IUPAC name of CID 14316656 (CID 14316656) is not available.
What is the SMILES notation for CID 14316656?
The canonical SMILES for CID 14316656 is Cl[C](Cl)Br.
What is the InChIKey of CID 14316656?
The InChIKey is IUYPEHPYBDZIAN-UHFFFAOYSA-N. The full InChI is InChI=1S/CBrCl2/c2-1(3)4.
What are the key properties of CID 14316656?
CID 14316656 has a molecular weight of 162.82 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 14316656 is sourced from PubChem (CID 14316656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).