C20H29NO3 — CID 143166569
ethane;[(E)-3-[(3E,5E)-5-nitrohepta-1,3,5-trien-4-yl]oxyprop-1-enyl]benzene (PubChem CID 143166569) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is ethane;[(E)-3-[(3E,5E)-5-nitrohepta-1,3,5-trien-4-yl]oxyprop-1-enyl]benzene.
| Compound Name | ethane;[(E)-3-[(3E,5E)-5-nitrohepta-1,3,5-trien-4-yl]oxyprop-1-enyl]benzene |
|---|---|
| PubChem CID | 143166569 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | ethane;[(E)-3-[(3E,5E)-5-nitrohepta-1,3,5-trien-4-yl]oxyprop-1-enyl]benzene |
| SMILES | C=C/C=C(OC/C=C/c1ccccc1)\C(=C/C)[N+](=O)[O-].CC.CC |
| InChI | InChI=1S/C16H17NO3.2C2H6/c1-3-9-16(15(4-2)17(18)19)20-13-8-12-14-10-6-5-7-11-14;2*1-2/h3-12H,1,13H2,2H3;2*1-2H3/b12-8+,15-4+,16-9+;; |
| InChIKey | HORIBVOXAIGRES-UXBJQORISA-N |
| XLogP | 6.02 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|