About ethane;6-propan-2-ylfuro[2,3-f]isoquinoline
ethane;6-propan-2-ylfuro[2,3-f]isoquinoline (PubChem CID 143166928) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is ethane;6-propan-2-ylfuro[2,3-f]isoquinoline.
Molecular Properties
| Compound Name | ethane;6-propan-2-ylfuro[2,3-f]isoquinoline |
| PubChem CID | 143166928 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | ethane;6-propan-2-ylfuro[2,3-f]isoquinoline |
| SMILES | CC.CC(C)c1nccc2c1ccc1ccoc12 |
| InChI | InChI=1S/C14H13NO.C2H6/c1-9(2)13-11-4-3-10-6-8-16-14(10)12(11)5-7-15-13;1-2/h3-9H,1-2H3;1-2H3 |
| InChIKey | MBGWCKLVMFNTFX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-propan-2-ylfuro[2,3-f]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-propan-2-ylfuro[2,3-f]isoquinoline?
The IUPAC name of ethane;6-propan-2-ylfuro[2,3-f]isoquinoline (CID 143166928) is ethane;6-propan-2-ylfuro[2,3-f]isoquinoline.
What is the SMILES notation for ethane;6-propan-2-ylfuro[2,3-f]isoquinoline?
The canonical SMILES for ethane;6-propan-2-ylfuro[2,3-f]isoquinoline is CC.CC(C)c1nccc2c1ccc1ccoc12.
What is the InChIKey of ethane;6-propan-2-ylfuro[2,3-f]isoquinoline?
The InChIKey is MBGWCKLVMFNTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO.C2H6/c1-9(2)13-11-4-3-10-6-8-16-14(10)12(11)5-7-15-13;1-2/h3-9H,1-2H3;1-2H3.
What are the key properties of ethane;6-propan-2-ylfuro[2,3-f]isoquinoline?
ethane;6-propan-2-ylfuro[2,3-f]isoquinoline has a molecular weight of 241.33 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-propan-2-ylfuro[2,3-f]isoquinoline is sourced from PubChem (CID 143166928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).