C23H30FN3O6 — CID 143167274
1-cyclobutyl-6-fluoro-7-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 143167274) has the molecular formula C23H30FN3O6 and a molecular weight of 463.51 g/mol. Its IUPAC name is 1-cyclobutyl-6-fluoro-7-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclobutyl-6-fluoro-7-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 143167274 |
| Molecular Formula | C23H30FN3O6 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 1-cyclobutyl-6-fluoro-7-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(N2CCN(CCOCCO)CC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CCC3)c12 |
| InChI | InChI=1S/C23H30FN3O6/c1-32-22-19-16(21(29)17(23(30)31)14-27(19)15-3-2-4-15)13-18(24)20(22)26-7-5-25(6-8-26)9-11-33-12-10-28/h13-15,28H,2-12H2,1H3,(H,30,31) |
| InChIKey | VAVCLGHRMWYXNW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|